C12H18O3 — CID 10774811
(1S,2S)-2-(hydroxymethyl)-1-phenylpentane-1,5-diol (PubChem CID 10774811) has the molecular formula C12H18O3 and a molecular weight of 210.27 g/mol. Its IUPAC name is (1S,2S)-2-(hydroxymethyl)-1-phenylpentane-1,5-diol.
| Compound Name | (1S,2S)-2-(hydroxymethyl)-1-phenylpentane-1,5-diol |
|---|---|
| PubChem CID | 10774811 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | (1S,2S)-2-(hydroxymethyl)-1-phenylpentane-1,5-diol |
| SMILES | OCCC[C@@H](CO)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C12H18O3/c13-8-4-7-11(9-14)12(15)10-5-2-1-3-6-10/h1-3,5-6,11-15H,4,7-9H2/t11-,12+/m0/s1 |
| InChIKey | BQGGJUQXGBAATK-NWDGAFQWSA-N |
| XLogP | 1.10 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |