C17H21NO2 — CID 14391185
3-[(2-hydroxy-1,2-diphenylethyl)amino]propan-1-ol (PubChem CID 14391185) has the molecular formula C17H21NO2 and a molecular weight of 271.36 g/mol. Its IUPAC name is 3-[(2-hydroxy-1,2-diphenylethyl)amino]propan-1-ol.
| Compound Name | 3-[(2-hydroxy-1,2-diphenylethyl)amino]propan-1-ol |
|---|---|
| PubChem CID | 14391185 |
| Molecular Formula | C17H21NO2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | 3-[(2-hydroxy-1,2-diphenylethyl)amino]propan-1-ol |
| SMILES | OCCCNC(c1ccccc1)C(O)c1ccccc1 |
| InChI | InChI=1S/C17H21NO2/c19-13-7-12-18-16(14-8-3-1-4-9-14)17(20)15-10-5-2-6-11-15/h1-6,8-11,16-20H,7,12-13H2 |
| InChIKey | XXVZFHVNEXASPA-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|