C12H17NO4 — CID 82347220
4-hydroxy-3-(2-hydroxyethylamino)-4-phenylbutanoic acid (PubChem CID 82347220) has the molecular formula C12H17NO4 and a molecular weight of 239.27 g/mol. Its IUPAC name is 4-hydroxy-3-(2-hydroxyethylamino)-4-phenylbutanoic acid.
| Compound Name | 4-hydroxy-3-(2-hydroxyethylamino)-4-phenylbutanoic acid |
|---|---|
| PubChem CID | 82347220 |
| Molecular Formula | C12H17NO4 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | 4-hydroxy-3-(2-hydroxyethylamino)-4-phenylbutanoic acid |
| SMILES | O=C(O)CC(NCCO)C(O)c1ccccc1 |
| InChI | InChI=1S/C12H17NO4/c14-7-6-13-10(8-11(15)16)12(17)9-4-2-1-3-5-9/h1-5,10,12-14,17H,6-8H2,(H,15,16) |
| InChIKey | YXKOPERGZMAPQT-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |