C11H14Cl3NO3 — CID 172835008
2,2-dichloro-N-(1,3-dihydroxy-1-phenylpropan-2-yl)acetamide;hydrochloride (PubChem CID 172835008) has the molecular formula C11H14Cl3NO3 and a molecular weight of 314.60 g/mol. Its IUPAC name is 2,2-dichloro-N-(1,3-dihydroxy-1-phenylpropan-2-yl)acetamide;hydrochloride.
| Compound Name | 2,2-dichloro-N-(1,3-dihydroxy-1-phenylpropan-2-yl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 172835008 |
| Molecular Formula | C11H14Cl3NO3 |
| Molecular Weight | 314.60 g/mol |
| Exact Mass | 313.00 |
| IUPAC Name | 2,2-dichloro-N-(1,3-dihydroxy-1-phenylpropan-2-yl)acetamide;hydrochloride |
| SMILES | Cl.O=C(NC(CO)C(O)c1ccccc1)C(Cl)Cl |
| InChI | InChI=1S/C11H13Cl2NO3.ClH/c12-10(13)11(17)14-8(6-15)9(16)7-4-2-1-3-5-7;/h1-5,8-10,15-16H,6H2,(H,14,17);1H |
| InChIKey | WALSBJSXHNHNGW-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.60 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|