C11H12Cl3NO3 — CID 23274982
2,2-dichloro-N-[1-(4-chlorophenyl)-1,3-dihydroxypropan-2-yl]acetamide (PubChem CID 23274982) has the molecular formula C11H12Cl3NO3 and a molecular weight of 312.58 g/mol. Its IUPAC name is 2,2-dichloro-N-[1-(4-chlorophenyl)-1,3-dihydroxypropan-2-yl]acetamide.
| Compound Name | 2,2-dichloro-N-[1-(4-chlorophenyl)-1,3-dihydroxypropan-2-yl]acetamide |
|---|---|
| PubChem CID | 23274982 |
| Molecular Formula | C11H12Cl3NO3 |
| Molecular Weight | 312.58 g/mol |
| Exact Mass | 310.99 |
| IUPAC Name | 2,2-dichloro-N-[1-(4-chlorophenyl)-1,3-dihydroxypropan-2-yl]acetamide |
| SMILES | O=C(NC(CO)C(O)c1ccc(Cl)cc1)C(Cl)Cl |
| InChI | InChI=1S/C11H12Cl3NO3/c12-7-3-1-6(2-4-7)9(17)8(5-16)15-11(18)10(13)14/h1-4,8-10,16-17H,5H2,(H,15,18) |
| InChIKey | ZVKMXUKKEAIIMD-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.58 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|