C14H22Cl2N2O11S2 — CID 21119441
2-aminoacetic acid;2,2-dichloro-N-[(1R,2R)-1,3-dihydroxy-1-(4-methylsulfonylphenyl)propan-2-yl]acetamide;sulfuric acid (PubChem CID 21119441) has the molecular formula C14H22Cl2N2O11S2 and a molecular weight of 529.37 g/mol. Its IUPAC name is 2-aminoacetic acid;2,2-dichloro-N-[(1R,2R)-1,3-dihydroxy-1-(4-methylsulfonylphenyl)propan-2-yl]acetamide;sulfuric acid.
| Compound Name | 2-aminoacetic acid;2,2-dichloro-N-[(1R,2R)-1,3-dihydroxy-1-(4-methylsulfonylphenyl)propan-2-yl]acetamide;sulfuric acid |
|---|---|
| PubChem CID | 21119441 |
| Molecular Formula | C14H22Cl2N2O11S2 |
| Molecular Weight | 529.37 g/mol |
| Exact Mass | 528.00 |
| IUPAC Name | 2-aminoacetic acid;2,2-dichloro-N-[(1R,2R)-1,3-dihydroxy-1-(4-methylsulfonylphenyl)propan-2-yl]acetamide;sulfuric acid |
| SMILES | CS(=O)(=O)c1ccc([C@@H](O)[C@@H](CO)NC(=O)C(Cl)Cl)cc1.NCC(=O)O.O=S(=O)(O)O |
| InChI | InChI=1S/C12H15Cl2NO5S.C2H5NO2.H2O4S/c1-21(19,20)8-4-2-7(3-5-8)10(17)9(6-16)15-12(18)11(13)14;3-1-2(4)5;1-5(2,3)4/h2-5,9-11,16-17H,6H2,1H3,(H,15,18);1,3H2,(H,4,5);(H2,1,2,3,4)/t9-,10-;;/m1../s1 |
| InChIKey | FLDPGAPSQNRFNW-HSTMFJOWSA-N |
| XLogP | -1.22 |
| TPSA | 241.62 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.37 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|