C11H15NO5S — CID 171777382
(3R,4S)-3-amino-4-hydroxy-4-(4-methylsulfonylphenyl)butanoic acid (PubChem CID 171777382) has the molecular formula C11H15NO5S and a molecular weight of 273.31 g/mol. Its IUPAC name is (3R,4S)-3-amino-4-hydroxy-4-(4-methylsulfonylphenyl)butanoic acid.
| Compound Name | (3R,4S)-3-amino-4-hydroxy-4-(4-methylsulfonylphenyl)butanoic acid |
|---|---|
| PubChem CID | 171777382 |
| Molecular Formula | C11H15NO5S |
| Molecular Weight | 273.31 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | (3R,4S)-3-amino-4-hydroxy-4-(4-methylsulfonylphenyl)butanoic acid |
| SMILES | CS(=O)(=O)c1ccc([C@H](O)[C@H](N)CC(=O)O)cc1 |
| InChI | InChI=1S/C11H15NO5S/c1-18(16,17)8-4-2-7(3-5-8)11(15)9(12)6-10(13)14/h2-5,9,11,15H,6,12H2,1H3,(H,13,14)/t9-,11+/m1/s1 |
| InChIKey | VUNLLCCQWBIRON-KOLCDFICSA-N |
| XLogP | -0.07 |
| TPSA | 117.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.31 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |