C10H13NO5S — CID 67747060
(2S,3R)-2-amino-3-hydroxy-3-(4-methylsulfonylphenyl)propanoic acid (PubChem CID 67747060) has the molecular formula C10H13NO5S and a molecular weight of 259.28 g/mol. Its IUPAC name is (2S,3R)-2-amino-3-hydroxy-3-(4-methylsulfonylphenyl)propanoic acid.
| Compound Name | (2S,3R)-2-amino-3-hydroxy-3-(4-methylsulfonylphenyl)propanoic acid |
|---|---|
| PubChem CID | 67747060 |
| Molecular Formula | C10H13NO5S |
| Molecular Weight | 259.28 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | (2S,3R)-2-amino-3-hydroxy-3-(4-methylsulfonylphenyl)propanoic acid |
| SMILES | CS(=O)(=O)c1ccc([C@@H](O)[C@H](N)C(=O)O)cc1 |
| InChI | InChI=1S/C10H13NO5S/c1-17(15,16)7-4-2-6(3-5-7)9(12)8(11)10(13)14/h2-5,8-9,12H,11H2,1H3,(H,13,14)/t8-,9+/m0/s1 |
| InChIKey | OTAAFSSMHIARNW-DTWKUNHWSA-N |
| XLogP | -0.46 |
| TPSA | 117.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.28 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |