C10H13NO4 — CID 10965805
(2S,3R)-2-amino-3-hydroxy-3-(4-methoxyphenyl)propanoic acid (PubChem CID 10965805) has the molecular formula C10H13NO4 and a molecular weight of 211.22 g/mol. Its IUPAC name is (2S,3R)-2-amino-3-hydroxy-3-(4-methoxyphenyl)propanoic acid.
| Compound Name | (2S,3R)-2-amino-3-hydroxy-3-(4-methoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 10965805 |
| Molecular Formula | C10H13NO4 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | (2S,3R)-2-amino-3-hydroxy-3-(4-methoxyphenyl)propanoic acid |
| SMILES | COc1ccc([C@@H](O)[C@H](N)C(=O)O)cc1 |
| InChI | InChI=1S/C10H13NO4/c1-15-7-4-2-6(3-5-7)9(12)8(11)10(13)14/h2-5,8-9,12H,11H2,1H3,(H,13,14)/t8-,9+/m0/s1 |
| InChIKey | YEMITEDRQMFNKS-DTWKUNHWSA-N |
| XLogP | 0.14 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |