C15H16Cl2N2Na2O9 — CID 67035474
disodium;butanedioate;2,2-dichloro-N-[(1R,2R)-1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]acetamide (PubChem CID 67035474) has the molecular formula C15H16Cl2N2Na2O9 and a molecular weight of 485.18 g/mol. Its IUPAC name is disodium;butanedioate;2,2-dichloro-N-[(1R,2R)-1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]acetamide.
| Compound Name | disodium;butanedioate;2,2-dichloro-N-[(1R,2R)-1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]acetamide |
|---|---|
| PubChem CID | 67035474 |
| Molecular Formula | C15H16Cl2N2Na2O9 |
| Molecular Weight | 485.18 g/mol |
| Exact Mass | 484.00 |
| IUPAC Name | disodium;butanedioate;2,2-dichloro-N-[(1R,2R)-1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]acetamide |
| SMILES | O=C(N[C@H](CO)[C@H](O)c1ccc([N+](=O)[O-])cc1)C(Cl)Cl.O=C([O-])CCC(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C11H12Cl2N2O5.C4H6O4.2Na/c12-10(13)11(18)14-8(5-16)9(17)6-1-3-7(4-2-6)15(19)20;5-3(6)1-2-4(7)8;;/h1-4,8-10,16-17H,5H2,(H,14,18);1-2H2,(H,5,6)(H,7,8);;/q;;2*+1/p-2/t8-,9-;;;/m1.../s1 |
| InChIKey | QVDFYHYYSZMNKO-YDVRIUSYSA-L |
| XLogP | -7.82 |
| TPSA | 192.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.18 |
| LogP ≤ 5 | -7.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|