C13H17NO3 — CID 101364759
N-[(1S,2S)-1,3-dihydroxy-1-phenylpropan-2-yl]-2-methylprop-2-enamide (PubChem CID 101364759) has the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. Its IUPAC name is N-[(1S,2S)-1,3-dihydroxy-1-phenylpropan-2-yl]-2-methylprop-2-enamide.
| Compound Name | N-[(1S,2S)-1,3-dihydroxy-1-phenylpropan-2-yl]-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 101364759 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | N-[(1S,2S)-1,3-dihydroxy-1-phenylpropan-2-yl]-2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)N[C@@H](CO)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C13H17NO3/c1-9(2)13(17)14-11(8-15)12(16)10-6-4-3-5-7-10/h3-7,11-12,15-16H,1,8H2,2H3,(H,14,17)/t11-,12-/m0/s1 |
| InChIKey | QEKFGAGVMBCKIS-RYUDHWBXSA-N |
| XLogP | 0.77 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|