C10H13NO3 — CID 13382276
N-[(1S,2S)-1,3-dihydroxy-1-phenylpropan-2-yl]formamide (PubChem CID 13382276) has the molecular formula C10H13NO3 and a molecular weight of 195.22 g/mol. Its IUPAC name is N-[(1S,2S)-1,3-dihydroxy-1-phenylpropan-2-yl]formamide.
| Compound Name | N-[(1S,2S)-1,3-dihydroxy-1-phenylpropan-2-yl]formamide |
|---|---|
| PubChem CID | 13382276 |
| Molecular Formula | C10H13NO3 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | N-[(1S,2S)-1,3-dihydroxy-1-phenylpropan-2-yl]formamide |
| SMILES | O=CN[C@@H](CO)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C10H13NO3/c12-6-9(11-7-13)10(14)8-4-2-1-3-5-8/h1-5,7,9-10,12,14H,6H2,(H,11,13)/t9-,10-/m0/s1 |
| InChIKey | CUSRFBSABVLCRF-UWVGGRQHSA-N |
| XLogP | -0.17 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|