C11H15N2O5- — CID 163165268
N-[(1R,2R)-1,3-dihydroxy-1-[4-[hydroxy(oxido)amino]phenyl]propan-2-yl]acetamide (PubChem CID 163165268) has the molecular formula C11H15N2O5- and a molecular weight of 255.25 g/mol. Its IUPAC name is N-[(1R,2R)-1,3-dihydroxy-1-[4-[hydroxy(oxido)amino]phenyl]propan-2-yl]acetamide.
| Compound Name | N-[(1R,2R)-1,3-dihydroxy-1-[4-[hydroxy(oxido)amino]phenyl]propan-2-yl]acetamide |
|---|---|
| PubChem CID | 163165268 |
| Molecular Formula | C11H15N2O5- |
| Molecular Weight | 255.25 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | N-[(1R,2R)-1,3-dihydroxy-1-[4-[hydroxy(oxido)amino]phenyl]propan-2-yl]acetamide |
| SMILES | CC(=O)N[C@H](CO)[C@H](O)c1ccc(N([O-])O)cc1 |
| InChI | InChI=1S/C11H15N2O5/c1-7(15)12-10(6-14)11(16)8-2-4-9(5-3-8)13(17)18/h2-5,10-11,14,16-17H,6H2,1H3,(H,12,15)/q-1/t10-,11-/m1/s1 |
| InChIKey | LBPYOOVLDNIAIQ-GHMZBOCLSA-N |
| XLogP | -0.09 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.25 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|