C12H17N2O5- — CID 163155483
N-[1,3-dihydroxy-1-[4-[hydroxy(oxido)amino]phenyl]propan-2-yl]propanamide (PubChem CID 163155483) has the molecular formula C12H17N2O5- and a molecular weight of 269.28 g/mol. Its IUPAC name is N-[1,3-dihydroxy-1-[4-[hydroxy(oxido)amino]phenyl]propan-2-yl]propanamide.
| Compound Name | N-[1,3-dihydroxy-1-[4-[hydroxy(oxido)amino]phenyl]propan-2-yl]propanamide |
|---|---|
| PubChem CID | 163155483 |
| Molecular Formula | C12H17N2O5- |
| Molecular Weight | 269.28 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | N-[1,3-dihydroxy-1-[4-[hydroxy(oxido)amino]phenyl]propan-2-yl]propanamide |
| SMILES | CCC(=O)NC(CO)C(O)c1ccc(N([O-])O)cc1 |
| InChI | InChI=1S/C12H17N2O5/c1-2-11(16)13-10(7-15)12(17)8-3-5-9(6-4-8)14(18)19/h3-6,10,12,15,17-18H,2,7H2,1H3,(H,13,16)/q-1 |
| InChIKey | NRZYESWBQIUNFI-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.28 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|