C17H21NOS — CID 19806393
2-(2-methylsulfanylethylamino)-1,2-diphenylethanol (PubChem CID 19806393) has the molecular formula C17H21NOS and a molecular weight of 287.43 g/mol. Its IUPAC name is 2-(2-methylsulfanylethylamino)-1,2-diphenylethanol.
| Compound Name | 2-(2-methylsulfanylethylamino)-1,2-diphenylethanol |
|---|---|
| PubChem CID | 19806393 |
| Molecular Formula | C17H21NOS |
| Molecular Weight | 287.43 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | 2-(2-methylsulfanylethylamino)-1,2-diphenylethanol |
| SMILES | CSCCNC(c1ccccc1)C(O)c1ccccc1 |
| InChI | InChI=1S/C17H21NOS/c1-20-13-12-18-16(14-8-4-2-5-9-14)17(19)15-10-6-3-7-11-15/h2-11,16-19H,12-13H2,1H3 |
| InChIKey | ZVAMJCFHTUBTNJ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.43 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|