C24H27NO — CID 11772348
(1R,2S)-1,2-diphenyl-2-[(2,4,6-trimethylphenyl)methylamino]ethanol (PubChem CID 11772348) has the molecular formula C24H27NO and a molecular weight of 345.49 g/mol. Its IUPAC name is (1R,2S)-1,2-diphenyl-2-[(2,4,6-trimethylphenyl)methylamino]ethanol.
| Compound Name | (1R,2S)-1,2-diphenyl-2-[(2,4,6-trimethylphenyl)methylamino]ethanol |
|---|---|
| PubChem CID | 11772348 |
| Molecular Formula | C24H27NO |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | (1R,2S)-1,2-diphenyl-2-[(2,4,6-trimethylphenyl)methylamino]ethanol |
| SMILES | Cc1cc(C)c(CN[C@@H](c2ccccc2)[C@H](O)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C24H27NO/c1-17-14-18(2)22(19(3)15-17)16-25-23(20-10-6-4-7-11-20)24(26)21-12-8-5-9-13-21/h4-15,23-26H,16H2,1-3H3/t23-,24+/m0/s1 |
| InChIKey | KSMDHRMUIUCFQV-BJKOFHAPSA-N |
| XLogP | 5.18 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |