C20H19NO — CID 1236280
(1S,2S)-2-anilino-1,2-diphenylethanol (PubChem CID 1236280) has the molecular formula C20H19NO and a molecular weight of 289.38 g/mol. Its IUPAC name is (1S,2S)-2-anilino-1,2-diphenylethanol.
| Compound Name | (1S,2S)-2-anilino-1,2-diphenylethanol |
|---|---|
| PubChem CID | 1236280 |
| Molecular Formula | C20H19NO |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | (1S,2S)-2-anilino-1,2-diphenylethanol |
| SMILES | O[C@@H](c1ccccc1)[C@@H](Nc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H19NO/c22-20(17-12-6-2-7-13-17)19(16-10-4-1-5-11-16)21-18-14-8-3-9-15-18/h1-15,19-22H/t19-,20-/m0/s1 |
| InChIKey | YSXHSIGXGNGIRZ-PMACEKPBSA-N |
| XLogP | 4.57 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |