C21H21NO2 — CID 11174608
(1R,2R)-2-(2-methoxyanilino)-1,2-diphenylethanol (PubChem CID 11174608) has the molecular formula C21H21NO2 and a molecular weight of 319.40 g/mol. Its IUPAC name is (1R,2R)-2-(2-methoxyanilino)-1,2-diphenylethanol.
| Compound Name | (1R,2R)-2-(2-methoxyanilino)-1,2-diphenylethanol |
|---|---|
| PubChem CID | 11174608 |
| Molecular Formula | C21H21NO2 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | (1R,2R)-2-(2-methoxyanilino)-1,2-diphenylethanol |
| SMILES | COc1ccccc1N[C@H](c1ccccc1)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C21H21NO2/c1-24-19-15-9-8-14-18(19)22-20(16-10-4-2-5-11-16)21(23)17-12-6-3-7-13-17/h2-15,20-23H,1H3/t20-,21-/m1/s1 |
| InChIKey | DYPKEHBSWJHBRQ-NHCUHLMSSA-N |
| XLogP | 4.58 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |