C18H21NO4 — CID 101189874
ethyl (2R,3R)-2-hydroxy-3-(2-methoxyanilino)-3-phenylpropanoate (PubChem CID 101189874) has the molecular formula C18H21NO4 and a molecular weight of 315.37 g/mol. Its IUPAC name is ethyl (2R,3R)-2-hydroxy-3-(2-methoxyanilino)-3-phenylpropanoate.
| Compound Name | ethyl (2R,3R)-2-hydroxy-3-(2-methoxyanilino)-3-phenylpropanoate |
|---|---|
| PubChem CID | 101189874 |
| Molecular Formula | C18H21NO4 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | ethyl (2R,3R)-2-hydroxy-3-(2-methoxyanilino)-3-phenylpropanoate |
| SMILES | CCOC(=O)[C@H](O)[C@H](Nc1ccccc1OC)c1ccccc1 |
| InChI | InChI=1S/C18H21NO4/c1-3-23-18(21)17(20)16(13-9-5-4-6-10-13)19-14-11-7-8-12-15(14)22-2/h4-12,16-17,19-20H,3H2,1-2H3/t16-,17-/m1/s1 |
| InChIKey | JQWTYTRFQTYOHH-IAGOWNOFSA-N |
| XLogP | 2.77 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |