C22H21NO — CID 11056163
(2R,3S)-3-anilino-2-methyl-1,3-diphenylpropan-1-one (PubChem CID 11056163) has the molecular formula C22H21NO and a molecular weight of 315.42 g/mol. Its IUPAC name is (2R,3S)-3-anilino-2-methyl-1,3-diphenylpropan-1-one.
| Compound Name | (2R,3S)-3-anilino-2-methyl-1,3-diphenylpropan-1-one |
|---|---|
| PubChem CID | 11056163 |
| Molecular Formula | C22H21NO |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | (2R,3S)-3-anilino-2-methyl-1,3-diphenylpropan-1-one |
| SMILES | C[C@@H](C(=O)c1ccccc1)[C@H](Nc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H21NO/c1-17(22(24)19-13-7-3-8-14-19)21(18-11-5-2-6-12-18)23-20-15-9-4-10-16-20/h2-17,21,23H,1H3/t17-,21+/m1/s1 |
| InChIKey | WFROBYGOEFWUAA-UTKZUKDTSA-N |
| XLogP | 5.36 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |