C18H21NO3 — CID 132509763
methyl (2S,3S)-2-[(S)-anilino(phenyl)methyl]-3-hydroxybutanoate (PubChem CID 132509763) has the molecular formula C18H21NO3 and a molecular weight of 299.37 g/mol. Its IUPAC name is methyl (2S,3S)-2-[(S)-anilino(phenyl)methyl]-3-hydroxybutanoate.
| Compound Name | methyl (2S,3S)-2-[(S)-anilino(phenyl)methyl]-3-hydroxybutanoate |
|---|---|
| PubChem CID | 132509763 |
| Molecular Formula | C18H21NO3 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | methyl (2S,3S)-2-[(S)-anilino(phenyl)methyl]-3-hydroxybutanoate |
| SMILES | COC(=O)[C@H]([C@H](C)O)[C@H](Nc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H21NO3/c1-13(20)16(18(21)22-2)17(14-9-5-3-6-10-14)19-15-11-7-4-8-12-15/h3-13,16-17,19-20H,1-2H3/t13-,16+,17+/m0/s1 |
| InChIKey | JNZLZCMTLSJJIN-IAOVAPTHSA-N |
| XLogP | 3.01 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |