About methyl 2-anilinopropanoate
methyl 2-anilinopropanoate (PubChem CID 3417283) has the molecular formula C10H13NO2
and a molecular weight of 179.22 g/mol. Its IUPAC name is methyl 2-anilinopropanoate.
Molecular Properties
| Compound Name | methyl 2-anilinopropanoate |
| PubChem CID | 3417283 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | methyl 2-anilinopropanoate |
| SMILES | COC(=O)C(C)Nc1ccccc1 |
| InChI | InChI=1S/C10H13NO2/c1-8(10(12)13-2)11-9-6-4-3-5-7-9/h3-8,11H,1-2H3 |
| InChIKey | RBAUAHIPDXKQJI-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 2-anilinopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-anilinopropanoate?
The IUPAC name of methyl 2-anilinopropanoate (CID 3417283) is methyl 2-anilinopropanoate.
What is the SMILES notation for methyl 2-anilinopropanoate?
The canonical SMILES for methyl 2-anilinopropanoate is COC(=O)C(C)Nc1ccccc1.
What is the InChIKey of methyl 2-anilinopropanoate?
The InChIKey is RBAUAHIPDXKQJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO2/c1-8(10(12)13-2)11-9-6-4-3-5-7-9/h3-8,11H,1-2H3.
What are the key properties of methyl 2-anilinopropanoate?
methyl 2-anilinopropanoate has a molecular weight of 179.22 g/mol, XLogP of 1.66, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-anilinopropanoate is sourced from PubChem (CID 3417283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).