About (2R)-2-anilinopropanoate
(2R)-2-anilinopropanoate (PubChem CID 6946450) has the molecular formula C9H10NO2-
and a molecular weight of 164.18 g/mol. Its IUPAC name is (2R)-2-anilinopropanoate.
Molecular Properties
| Compound Name | (2R)-2-anilinopropanoate |
| PubChem CID | 6946450 |
| Molecular Formula | C9H10NO2- |
| Molecular Weight | 164.18 g/mol |
| Exact Mass | 164.07 |
| IUPAC Name | (2R)-2-anilinopropanoate |
| SMILES | C[C@@H](Nc1ccccc1)C(=O)[O-] |
| InChI | InChI=1S/C9H11NO2/c1-7(9(11)12)10-8-5-3-2-4-6-8/h2-7,10H,1H3,(H,11,12)/p-1/t7-/m1/s1 |
| InChIKey | XWKAVQKJQBISOL-SSDOTTSWSA-M |
| XLogP | 0.24 |
| TPSA | 52.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.18 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R)-2-anilinopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-anilinopropanoate?
The IUPAC name of (2R)-2-anilinopropanoate (CID 6946450) is (2R)-2-anilinopropanoate.
What is the SMILES notation for (2R)-2-anilinopropanoate?
The canonical SMILES for (2R)-2-anilinopropanoate is C[C@@H](Nc1ccccc1)C(=O)[O-].
What is the InChIKey of (2R)-2-anilinopropanoate?
The InChIKey is XWKAVQKJQBISOL-SSDOTTSWSA-M. The full InChI is InChI=1S/C9H11NO2/c1-7(9(11)12)10-8-5-3-2-4-6-8/h2-7,10H,1H3,(H,11,12)/p-1/t7-/m1/s1.
What are the key properties of (2R)-2-anilinopropanoate?
(2R)-2-anilinopropanoate has a molecular weight of 164.18 g/mol, XLogP of 0.24, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-anilinopropanoate is sourced from PubChem (CID 6946450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).