acetaldehyde;2-anilinopropanoyl chloride

C11H14ClNO2 — CID 174623203

IUPACacetaldehyde;2-anilinopropanoyl chloride
SMILESCC(Nc1ccccc1)C(=O)Cl.CC=O
InChIInChI=1S/C9H10ClNO.C2H4O/c1-7(9(10)12)11-8-5-3-2-4-6-8;1-2-3/h2-7,11H,1H3;2H,1H3
InChIKeyMZUNTKUSWFCJEW-UHFFFAOYSA-N
MW227.69 g/mol
LogP2.46
Rot. Bonds3

About acetaldehyde;2-anilinopropanoyl chloride

acetaldehyde;2-anilinopropanoyl chloride (PubChem CID 174623203) has the molecular formula C11H14ClNO2 and a molecular weight of 227.69 g/mol. Its IUPAC name is acetaldehyde;2-anilinopropanoyl chloride.

Molecular Properties

Compound Nameacetaldehyde;2-anilinopropanoyl chloride
PubChem CID174623203
Molecular FormulaC11H14ClNO2
Molecular Weight227.69 g/mol
Exact Mass227.07
IUPAC Nameacetaldehyde;2-anilinopropanoyl chloride
SMILESCC(Nc1ccccc1)C(=O)Cl.CC=O
InChIInChI=1S/C9H10ClNO.C2H4O/c1-7(9(10)12)11-8-5-3-2-4-6-8;1-2-3/h2-7,11H,1H3;2H,1H3
InChIKeyMZUNTKUSWFCJEW-UHFFFAOYSA-N
XLogP2.46
TPSA46.17 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500227.69
LogP ≤ 52.46
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}

Analyze acetaldehyde;2-anilinopropanoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of acetaldehyde;2-anilinopropanoyl chloride?
The IUPAC name of acetaldehyde;2-anilinopropanoyl chloride (CID 174623203) is acetaldehyde;2-anilinopropanoyl chloride.
What is the SMILES notation for acetaldehyde;2-anilinopropanoyl chloride?
The canonical SMILES for acetaldehyde;2-anilinopropanoyl chloride is CC(Nc1ccccc1)C(=O)Cl.CC=O.
What is the InChIKey of acetaldehyde;2-anilinopropanoyl chloride?
The InChIKey is MZUNTKUSWFCJEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10ClNO.C2H4O/c1-7(9(10)12)11-8-5-3-2-4-6-8;1-2-3/h2-7,11H,1H3;2H,1H3.
What are the key properties of acetaldehyde;2-anilinopropanoyl chloride?
acetaldehyde;2-anilinopropanoyl chloride has a molecular weight of 227.69 g/mol, XLogP of 2.46, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetaldehyde;2-anilinopropanoyl chloride is sourced from PubChem (CID 174623203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).