About acetaldehyde;2-anilinopropanoyl chloride
acetaldehyde;2-anilinopropanoyl chloride (PubChem CID 174623203) has the molecular formula C11H14ClNO2
and a molecular weight of 227.69 g/mol. Its IUPAC name is acetaldehyde;2-anilinopropanoyl chloride.
Molecular Properties
| Compound Name | acetaldehyde;2-anilinopropanoyl chloride |
| PubChem CID | 174623203 |
| Molecular Formula | C11H14ClNO2 |
| Molecular Weight | 227.69 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | acetaldehyde;2-anilinopropanoyl chloride |
| SMILES | CC(Nc1ccccc1)C(=O)Cl.CC=O |
| InChI | InChI=1S/C9H10ClNO.C2H4O/c1-7(9(10)12)11-8-5-3-2-4-6-8;1-2-3/h2-7,11H,1H3;2H,1H3 |
| InChIKey | MZUNTKUSWFCJEW-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.69 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze acetaldehyde;2-anilinopropanoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetaldehyde;2-anilinopropanoyl chloride?
The IUPAC name of acetaldehyde;2-anilinopropanoyl chloride (CID 174623203) is acetaldehyde;2-anilinopropanoyl chloride.
What is the SMILES notation for acetaldehyde;2-anilinopropanoyl chloride?
The canonical SMILES for acetaldehyde;2-anilinopropanoyl chloride is CC(Nc1ccccc1)C(=O)Cl.CC=O.
What is the InChIKey of acetaldehyde;2-anilinopropanoyl chloride?
The InChIKey is MZUNTKUSWFCJEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10ClNO.C2H4O/c1-7(9(10)12)11-8-5-3-2-4-6-8;1-2-3/h2-7,11H,1H3;2H,1H3.
What are the key properties of acetaldehyde;2-anilinopropanoyl chloride?
acetaldehyde;2-anilinopropanoyl chloride has a molecular weight of 227.69 g/mol, XLogP of 2.46, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetaldehyde;2-anilinopropanoyl chloride is sourced from PubChem (CID 174623203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).