About 2-anilinopropanoic acid;hydrochloride
2-anilinopropanoic acid;hydrochloride (PubChem CID 19096756) has the molecular formula C9H12ClNO2
and a molecular weight of 201.65 g/mol. Its IUPAC name is 2-anilinopropanoic acid;hydrochloride.
Molecular Properties
| Compound Name | 2-anilinopropanoic acid;hydrochloride |
| PubChem CID | 19096756 |
| Molecular Formula | C9H12ClNO2 |
| Molecular Weight | 201.65 g/mol |
| Exact Mass | 201.06 |
| IUPAC Name | 2-anilinopropanoic acid;hydrochloride |
| SMILES | CC(Nc1ccccc1)C(=O)O.Cl |
| InChI | InChI=1S/C9H11NO2.ClH/c1-7(9(11)12)10-8-5-3-2-4-6-8;/h2-7,10H,1H3,(H,11,12);1H |
| InChIKey | PVSXFZNUFZMVAC-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.65 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-anilinopropanoic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-anilinopropanoic acid;hydrochloride?
The IUPAC name of 2-anilinopropanoic acid;hydrochloride (CID 19096756) is 2-anilinopropanoic acid;hydrochloride.
What is the SMILES notation for 2-anilinopropanoic acid;hydrochloride?
The canonical SMILES for 2-anilinopropanoic acid;hydrochloride is CC(Nc1ccccc1)C(=O)O.Cl.
What is the InChIKey of 2-anilinopropanoic acid;hydrochloride?
The InChIKey is PVSXFZNUFZMVAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO2.ClH/c1-7(9(11)12)10-8-5-3-2-4-6-8;/h2-7,10H,1H3,(H,11,12);1H.
What are the key properties of 2-anilinopropanoic acid;hydrochloride?
2-anilinopropanoic acid;hydrochloride has a molecular weight of 201.65 g/mol, XLogP of 1.99, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-anilinopropanoic acid;hydrochloride is sourced from PubChem (CID 19096756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).