C17H19NO4 — CID 102470524
methyl (2S,3R)-2-hydroxy-3-(4-methoxyanilino)-3-phenylpropanoate (PubChem CID 102470524) has the molecular formula C17H19NO4 and a molecular weight of 301.34 g/mol. Its IUPAC name is methyl (2S,3R)-2-hydroxy-3-(4-methoxyanilino)-3-phenylpropanoate.
| Compound Name | methyl (2S,3R)-2-hydroxy-3-(4-methoxyanilino)-3-phenylpropanoate |
|---|---|
| PubChem CID | 102470524 |
| Molecular Formula | C17H19NO4 |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | methyl (2S,3R)-2-hydroxy-3-(4-methoxyanilino)-3-phenylpropanoate |
| SMILES | COC(=O)[C@@H](O)[C@H](Nc1ccc(OC)cc1)c1ccccc1 |
| InChI | InChI=1S/C17H19NO4/c1-21-14-10-8-13(9-11-14)18-15(16(19)17(20)22-2)12-6-4-3-5-7-12/h3-11,15-16,18-19H,1-2H3/t15-,16+/m1/s1 |
| InChIKey | RTJPAXCLKJTLHM-CVEARBPZSA-N |
| XLogP | 2.38 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|