C20H24ClNO5 — CID 102178402
methyl (2R,3S,4S,5S)-5-(4-chlorophenyl)-2,3-dihydroxy-5-(4-methoxyanilino)-4-methylpentanoate (PubChem CID 102178402) has the molecular formula C20H24ClNO5 and a molecular weight of 393.87 g/mol. Its IUPAC name is methyl (2R,3S,4S,5S)-5-(4-chlorophenyl)-2,3-dihydroxy-5-(4-methoxyanilino)-4-methylpentanoate.
| Compound Name | methyl (2R,3S,4S,5S)-5-(4-chlorophenyl)-2,3-dihydroxy-5-(4-methoxyanilino)-4-methylpentanoate |
|---|---|
| PubChem CID | 102178402 |
| Molecular Formula | C20H24ClNO5 |
| Molecular Weight | 393.87 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | methyl (2R,3S,4S,5S)-5-(4-chlorophenyl)-2,3-dihydroxy-5-(4-methoxyanilino)-4-methylpentanoate |
| SMILES | COC(=O)[C@H](O)[C@@H](O)[C@@H](C)[C@H](Nc1ccc(OC)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H24ClNO5/c1-12(18(23)19(24)20(25)27-3)17(13-4-6-14(21)7-5-13)22-15-8-10-16(26-2)11-9-15/h4-12,17-19,22-24H,1-3H3/t12-,17-,18-,19+/m0/s1 |
| InChIKey | CPXXPBPHAANXJZ-OZOSWLFCSA-N |
| XLogP | 3.03 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.87 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|