C22H28ClNO3S — CID 102167729
(3R,4R)-1-tert-butylsulfinyl-4-(4-chlorophenyl)-4-(4-methoxyanilino)-3-methylbutan-2-one (PubChem CID 102167729) has the molecular formula C22H28ClNO3S and a molecular weight of 421.99 g/mol. Its IUPAC name is (3R,4R)-1-tert-butylsulfinyl-4-(4-chlorophenyl)-4-(4-methoxyanilino)-3-methylbutan-2-one.
| Compound Name | (3R,4R)-1-tert-butylsulfinyl-4-(4-chlorophenyl)-4-(4-methoxyanilino)-3-methylbutan-2-one |
|---|---|
| PubChem CID | 102167729 |
| Molecular Formula | C22H28ClNO3S |
| Molecular Weight | 421.99 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | (3R,4R)-1-tert-butylsulfinyl-4-(4-chlorophenyl)-4-(4-methoxyanilino)-3-methylbutan-2-one |
| SMILES | COc1ccc(N[C@@H](c2ccc(Cl)cc2)[C@@H](C)C(=O)CS(=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C22H28ClNO3S/c1-15(20(25)14-28(26)22(2,3)4)21(16-6-8-17(23)9-7-16)24-18-10-12-19(27-5)13-11-18/h6-13,15,21,24H,14H2,1-5H3/t15-,21+,28?/m0/s1 |
| InChIKey | DCGNPISVMNQUIX-IMQBIJKUSA-N |
| XLogP | 5.25 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.99 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|