C20H24ClNO2 — CID 101435643
tert-butyl (2R,3S)-3-anilino-3-(4-chlorophenyl)-2-methylpropanoate (PubChem CID 101435643) has the molecular formula C20H24ClNO2 and a molecular weight of 345.87 g/mol. Its IUPAC name is tert-butyl (2R,3S)-3-anilino-3-(4-chlorophenyl)-2-methylpropanoate.
| Compound Name | tert-butyl (2R,3S)-3-anilino-3-(4-chlorophenyl)-2-methylpropanoate |
|---|---|
| PubChem CID | 101435643 |
| Molecular Formula | C20H24ClNO2 |
| Molecular Weight | 345.87 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | tert-butyl (2R,3S)-3-anilino-3-(4-chlorophenyl)-2-methylpropanoate |
| SMILES | C[C@@H](C(=O)OC(C)(C)C)[C@H](Nc1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H24ClNO2/c1-14(19(23)24-20(2,3)4)18(15-10-12-16(21)13-11-15)22-17-8-6-5-7-9-17/h5-14,18,22H,1-4H3/t14-,18+/m1/s1 |
| InChIKey | KEWGAZXQIOIRLL-KDOFPFPSSA-N |
| XLogP | 5.47 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.87 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |