C15H20ClNO3 — CID 102169131
tert-butyl N-[(1R,2R)-1-(4-chlorophenyl)-2-methyl-3-oxopropyl]carbamate (PubChem CID 102169131) has the molecular formula C15H20ClNO3 and a molecular weight of 297.78 g/mol. Its IUPAC name is tert-butyl N-[(1R,2R)-1-(4-chlorophenyl)-2-methyl-3-oxopropyl]carbamate.
| Compound Name | tert-butyl N-[(1R,2R)-1-(4-chlorophenyl)-2-methyl-3-oxopropyl]carbamate |
|---|---|
| PubChem CID | 102169131 |
| Molecular Formula | C15H20ClNO3 |
| Molecular Weight | 297.78 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | tert-butyl N-[(1R,2R)-1-(4-chlorophenyl)-2-methyl-3-oxopropyl]carbamate |
| SMILES | CC(C=O)[C@@H](NC(=O)OC(C)(C)C)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H20ClNO3/c1-10(9-18)13(11-5-7-12(16)8-6-11)17-14(19)20-15(2,3)4/h5-10,13H,1-4H3,(H,17,19)/t10?,13-/m1/s1 |
| InChIKey | JHBNLXMPQMMDDU-JLOHTSLTSA-N |
| XLogP | 3.74 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.78 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|