C13H16BrClN2O4 — CID 146162209
tert-butyl N-[(1S)-2-bromo-1-(4-chlorophenyl)-2-nitroethyl]carbamate (PubChem CID 146162209) has the molecular formula C13H16BrClN2O4 and a molecular weight of 379.64 g/mol. Its IUPAC name is tert-butyl N-[(1S)-2-bromo-1-(4-chlorophenyl)-2-nitroethyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-2-bromo-1-(4-chlorophenyl)-2-nitroethyl]carbamate |
|---|---|
| PubChem CID | 146162209 |
| Molecular Formula | C13H16BrClN2O4 |
| Molecular Weight | 379.64 g/mol |
| Exact Mass | 378.00 |
| IUPAC Name | tert-butyl N-[(1S)-2-bromo-1-(4-chlorophenyl)-2-nitroethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](c1ccc(Cl)cc1)C(Br)[N+](=O)[O-] |
| InChI | InChI=1S/C13H16BrClN2O4/c1-13(2,3)21-12(18)16-10(11(14)17(19)20)8-4-6-9(15)7-5-8/h4-7,10-11H,1-3H3,(H,16,18)/t10-,11?/m0/s1 |
| InChIKey | KHWUZDFEAALZJK-VUWPPUDQSA-N |
| XLogP | 3.90 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.64 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|