C21H26N2O4 — CID 86278065
tert-butyl N-[(1R,2S)-1,2-bis(4-methylphenyl)-2-nitroethyl]carbamate (PubChem CID 86278065) has the molecular formula C21H26N2O4 and a molecular weight of 370.45 g/mol. Its IUPAC name is tert-butyl N-[(1R,2S)-1,2-bis(4-methylphenyl)-2-nitroethyl]carbamate.
| Compound Name | tert-butyl N-[(1R,2S)-1,2-bis(4-methylphenyl)-2-nitroethyl]carbamate |
|---|---|
| PubChem CID | 86278065 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | tert-butyl N-[(1R,2S)-1,2-bis(4-methylphenyl)-2-nitroethyl]carbamate |
| SMILES | Cc1ccc([C@@H](NC(=O)OC(C)(C)C)[C@H](c2ccc(C)cc2)[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H26N2O4/c1-14-6-10-16(11-7-14)18(22-20(24)27-21(3,4)5)19(23(25)26)17-12-8-15(2)9-13-17/h6-13,18-19H,1-5H3,(H,22,24)/t18-,19+/m1/s1 |
| InChIKey | RRXYXOAOMFADLL-MOPGFXCFSA-N |
| XLogP | 4.89 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|