C27H32N2O4 — CID 122372767
tert-butyl N-[(1R,2S)-2-(4-tert-butylphenyl)-1-naphthalen-1-yl-2-nitroethyl]carbamate (PubChem CID 122372767) has the molecular formula C27H32N2O4 and a molecular weight of 448.56 g/mol. Its IUPAC name is tert-butyl N-[(1R,2S)-2-(4-tert-butylphenyl)-1-naphthalen-1-yl-2-nitroethyl]carbamate.
| Compound Name | tert-butyl N-[(1R,2S)-2-(4-tert-butylphenyl)-1-naphthalen-1-yl-2-nitroethyl]carbamate |
|---|---|
| PubChem CID | 122372767 |
| Molecular Formula | C27H32N2O4 |
| Molecular Weight | 448.56 g/mol |
| Exact Mass | 448.24 |
| IUPAC Name | tert-butyl N-[(1R,2S)-2-(4-tert-butylphenyl)-1-naphthalen-1-yl-2-nitroethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](c1cccc2ccccc12)[C@H](c1ccc(C(C)(C)C)cc1)[N+](=O)[O-] |
| InChI | InChI=1S/C27H32N2O4/c1-26(2,3)20-16-14-19(15-17-20)24(29(31)32)23(28-25(30)33-27(4,5)6)22-13-9-11-18-10-7-8-12-21(18)22/h7-17,23-24H,1-6H3,(H,28,30)/t23-,24+/m1/s1 |
| InChIKey | NCVCYKVJEITISN-RPWUZVMVSA-N |
| XLogP | 6.72 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.56 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|