C34H31NO4 — CID 102204031
dinaphthalen-1-ylmethyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-phenylacetate (PubChem CID 102204031) has the molecular formula C34H31NO4 and a molecular weight of 517.63 g/mol. Its IUPAC name is dinaphthalen-1-ylmethyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-phenylacetate.
| Compound Name | dinaphthalen-1-ylmethyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-phenylacetate |
|---|---|
| PubChem CID | 102204031 |
| Molecular Formula | C34H31NO4 |
| Molecular Weight | 517.63 g/mol |
| Exact Mass | 517.23 |
| IUPAC Name | dinaphthalen-1-ylmethyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-phenylacetate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](C(=O)OC(c1cccc2ccccc12)c1cccc2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C34H31NO4/c1-34(2,3)39-33(37)35-30(25-15-5-4-6-16-25)32(36)38-31(28-21-11-17-23-13-7-9-19-26(23)28)29-22-12-18-24-14-8-10-20-27(24)29/h4-22,30-31H,1-3H3,(H,35,37)/t30-/m1/s1 |
| InChIKey | ACWKLLMJGZDBHL-SSEXGKCCSA-N |
| XLogP | 7.89 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.63 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |