C21H23NO6 — CID 46946616
phenylmethoxycarbonyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-phenylacetate (PubChem CID 46946616) has the molecular formula C21H23NO6 and a molecular weight of 385.42 g/mol. Its IUPAC name is phenylmethoxycarbonyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-phenylacetate.
| Compound Name | phenylmethoxycarbonyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-phenylacetate |
|---|---|
| PubChem CID | 46946616 |
| Molecular Formula | C21H23NO6 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | phenylmethoxycarbonyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-phenylacetate |
| SMILES | CC(C)(C)OC(=O)N[C@H](C(=O)OC(=O)OCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H23NO6/c1-21(2,3)28-19(24)22-17(16-12-8-5-9-13-16)18(23)27-20(25)26-14-15-10-6-4-7-11-15/h4-13,17H,14H2,1-3H3,(H,22,24)/t17-/m0/s1 |
| InChIKey | KILJFSJBWBBMPD-KRWDZBQOSA-N |
| XLogP | 4.13 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|