C14H17NO6 — CID 102234074
ethoxycarbonyl (2S)-2-(ethoxycarbonylamino)-2-phenylacetate (PubChem CID 102234074) has the molecular formula C14H17NO6 and a molecular weight of 295.29 g/mol. Its IUPAC name is ethoxycarbonyl (2S)-2-(ethoxycarbonylamino)-2-phenylacetate.
| Compound Name | ethoxycarbonyl (2S)-2-(ethoxycarbonylamino)-2-phenylacetate |
|---|---|
| PubChem CID | 102234074 |
| Molecular Formula | C14H17NO6 |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | ethoxycarbonyl (2S)-2-(ethoxycarbonylamino)-2-phenylacetate |
| SMILES | CCOC(=O)N[C@H](C(=O)OC(=O)OCC)c1ccccc1 |
| InChI | InChI=1S/C14H17NO6/c1-3-19-13(17)15-11(10-8-6-5-7-9-10)12(16)21-14(18)20-4-2/h5-9,11H,3-4H2,1-2H3,(H,15,17)/t11-/m0/s1 |
| InChIKey | HGOKZJMLICIRGY-NSHDSACASA-N |
| XLogP | 2.17 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|