C14H19NO5 — CID 102239022
[(2R)-2-(ethoxycarbonylamino)-2-phenylethyl] ethyl carbonate (PubChem CID 102239022) has the molecular formula C14H19NO5 and a molecular weight of 281.31 g/mol. Its IUPAC name is [(2R)-2-(ethoxycarbonylamino)-2-phenylethyl] ethyl carbonate.
| Compound Name | [(2R)-2-(ethoxycarbonylamino)-2-phenylethyl] ethyl carbonate |
|---|---|
| PubChem CID | 102239022 |
| Molecular Formula | C14H19NO5 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | [(2R)-2-(ethoxycarbonylamino)-2-phenylethyl] ethyl carbonate |
| SMILES | CCOC(=O)N[C@@H](COC(=O)OCC)c1ccccc1 |
| InChI | InChI=1S/C14H19NO5/c1-3-18-13(16)15-12(10-20-14(17)19-4-2)11-8-6-5-7-9-11/h5-9,12H,3-4,10H2,1-2H3,(H,15,16)/t12-/m0/s1 |
| InChIKey | RPYOLZGTVVDDGF-LBPRGKRZSA-N |
| XLogP | 2.65 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |