C20H27NO9 — CID 88844476
ethoxycarbonyl ethyl carbonate;2-[[(E)-4-ethoxy-4-oxobut-2-en-2-yl]amino]-2-phenylacetic acid (PubChem CID 88844476) has the molecular formula C20H27NO9 and a molecular weight of 425.43 g/mol. Its IUPAC name is ethoxycarbonyl ethyl carbonate;2-[[(E)-4-ethoxy-4-oxobut-2-en-2-yl]amino]-2-phenylacetic acid.
| Compound Name | ethoxycarbonyl ethyl carbonate;2-[[(E)-4-ethoxy-4-oxobut-2-en-2-yl]amino]-2-phenylacetic acid |
|---|---|
| PubChem CID | 88844476 |
| Molecular Formula | C20H27NO9 |
| Molecular Weight | 425.43 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | ethoxycarbonyl ethyl carbonate;2-[[(E)-4-ethoxy-4-oxobut-2-en-2-yl]amino]-2-phenylacetic acid |
| SMILES | CCOC(=O)/C=C(\C)NC(C(=O)O)c1ccccc1.CCOC(=O)OC(=O)OCC |
| InChI | InChI=1S/C14H17NO4.C6H10O5/c1-3-19-12(16)9-10(2)15-13(14(17)18)11-7-5-4-6-8-11;1-3-9-5(7)11-6(8)10-4-2/h4-9,13,15H,3H2,1-2H3,(H,17,18);3-4H2,1-2H3/b10-9+; |
| InChIKey | NYSLNRTXDFJLDW-RRABGKBLSA-N |
| XLogP | 3.18 |
| TPSA | 137.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.43 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|