C13H14NNaO4 — CID 23684634
sodium (2R)-2-[[(E)-4-methoxy-4-oxobut-2-en-2-yl]amino]-2-phenylacetate (PubChem CID 23684634) has the molecular formula C13H14NNaO4 and a molecular weight of 271.25 g/mol. Its IUPAC name is sodium (2R)-2-[[(E)-4-methoxy-4-oxobut-2-en-2-yl]amino]-2-phenylacetate.
| Compound Name | sodium (2R)-2-[[(E)-4-methoxy-4-oxobut-2-en-2-yl]amino]-2-phenylacetate |
|---|---|
| PubChem CID | 23684634 |
| Molecular Formula | C13H14NNaO4 |
| Molecular Weight | 271.25 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | sodium (2R)-2-[[(E)-4-methoxy-4-oxobut-2-en-2-yl]amino]-2-phenylacetate |
| SMILES | COC(=O)/C=C(\C)N[C@@H](C(=O)[O-])c1ccccc1.[Na+] |
| InChI | InChI=1S/C13H15NO4.Na/c1-9(8-11(15)18-2)14-12(13(16)17)10-6-4-3-5-7-10;/h3-8,12,14H,1-2H3,(H,16,17);/q;+1/p-1/b9-8+;/t12-;/m1./s1 |
| InChIKey | VWAWMPXOFHGGMY-UYZIEVLVSA-M |
| XLogP | -2.85 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.25 |
| LogP ≤ 5 | -2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|