C13H14NO4Y- — CID 159631589
2-(4-hydroxyphenyl)-2-[[(E)-4-oxopent-2-en-2-yl]amino]acetate;yttrium (PubChem CID 159631589) has the molecular formula C13H14NO4Y- and a molecular weight of 337.16 g/mol. Its IUPAC name is 2-(4-hydroxyphenyl)-2-[[(E)-4-oxopent-2-en-2-yl]amino]acetate;yttrium.
| Compound Name | 2-(4-hydroxyphenyl)-2-[[(E)-4-oxopent-2-en-2-yl]amino]acetate;yttrium |
|---|---|
| PubChem CID | 159631589 |
| Molecular Formula | C13H14NO4Y- |
| Molecular Weight | 337.16 g/mol |
| Exact Mass | 337.00 |
| IUPAC Name | 2-(4-hydroxyphenyl)-2-[[(E)-4-oxopent-2-en-2-yl]amino]acetate;yttrium |
| SMILES | CC(=O)/C=C(\C)NC(C(=O)[O-])c1ccc(O)cc1.[Y] |
| InChI | InChI=1S/C13H15NO4.Y/c1-8(7-9(2)15)14-12(13(17)18)10-3-5-11(16)6-4-10;/h3-7,12,14,16H,1-2H3,(H,17,18);/p-1/b8-7+; |
| InChIKey | KFLFAONVXSHVIA-USRGLUTNSA-M |
| XLogP | 0.26 |
| TPSA | 89.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.16 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|