C15H16N3O6- — CID 7021031
(2R)-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-(4-hydroxyphenyl)acetate (PubChem CID 7021031) has the molecular formula C15H16N3O6- and a molecular weight of 334.31 g/mol. Its IUPAC name is (2R)-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-(4-hydroxyphenyl)acetate.
| Compound Name | (2R)-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-(4-hydroxyphenyl)acetate |
|---|---|
| PubChem CID | 7021031 |
| Molecular Formula | C15H16N3O6- |
| Molecular Weight | 334.31 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | (2R)-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-(4-hydroxyphenyl)acetate |
| SMILES | CCN1CCN(C(=O)N[C@@H](C(=O)[O-])c2ccc(O)cc2)C(=O)C1=O |
| InChI | InChI=1S/C15H17N3O6/c1-2-17-7-8-18(13(21)12(17)20)15(24)16-11(14(22)23)9-3-5-10(19)6-4-9/h3-6,11,19H,2,7-8H2,1H3,(H,16,24)(H,22,23)/p-1/t11-/m1/s1 |
| InChIKey | IPARGUVYMOMVNU-LLVKDONJSA-M |
| XLogP | -1.42 |
| TPSA | 130.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.31 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|