C16H22BN5O6 — CID 134814907
[[(2R)-2-(4-aminophenyl)-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]acetyl]amino]methylboronic acid (PubChem CID 134814907) has the molecular formula C16H22BN5O6 and a molecular weight of 391.19 g/mol. Its IUPAC name is [[(2R)-2-(4-aminophenyl)-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]acetyl]amino]methylboronic acid.
| Compound Name | [[(2R)-2-(4-aminophenyl)-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]acetyl]amino]methylboronic acid |
|---|---|
| PubChem CID | 134814907 |
| Molecular Formula | C16H22BN5O6 |
| Molecular Weight | 391.19 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | [[(2R)-2-(4-aminophenyl)-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]acetyl]amino]methylboronic acid |
| SMILES | CCN1CCN(C(=O)N[C@@H](C(=O)NCB(O)O)c2ccc(N)cc2)C(=O)C1=O |
| InChI | InChI=1S/C16H22BN5O6/c1-2-21-7-8-22(15(25)14(21)24)16(26)20-12(13(23)19-9-17(27)28)10-3-5-11(18)6-4-10/h3-6,12,27-28H,2,7-9,18H2,1H3,(H,19,23)(H,20,26)/t12-/m1/s1 |
| InChIKey | OYTCTWUGQSYSLU-GFCCVEGCSA-N |
| XLogP | -2.16 |
| TPSA | 165.30 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.19 |
| LogP ≤ 5 | -2.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|