C17H20N4O6 — CID 173444536
[[2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-phenylacetyl]amino]methyl formate (PubChem CID 173444536) has the molecular formula C17H20N4O6 and a molecular weight of 376.37 g/mol. Its IUPAC name is [[2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-phenylacetyl]amino]methyl formate.
| Compound Name | [[2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-phenylacetyl]amino]methyl formate |
|---|---|
| PubChem CID | 173444536 |
| Molecular Formula | C17H20N4O6 |
| Molecular Weight | 376.37 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | [[2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-phenylacetyl]amino]methyl formate |
| SMILES | CCN1CCN(C(=O)NC(C(=O)NCOC=O)c2ccccc2)C(=O)C1=O |
| InChI | InChI=1S/C17H20N4O6/c1-2-20-8-9-21(16(25)15(20)24)17(26)19-13(12-6-4-3-5-7-12)14(23)18-10-27-11-22/h3-7,11,13H,2,8-10H2,1H3,(H,18,23)(H,19,26) |
| InChIKey | KIHNYHXVRWKYKI-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 125.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.37 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|