C19H22KN5O9S — CID 23692943
potassium (3R)-3-[[2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-phenylacetyl]amino]-3-methoxy-2-oxoazetidine-1-sulfonate (PubChem CID 23692943) has the molecular formula C19H22KN5O9S and a molecular weight of 535.58 g/mol. Its IUPAC name is potassium (3R)-3-[[2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-phenylacetyl]amino]-3-methoxy-2-oxoazetidine-1-sulfonate.
| Compound Name | potassium (3R)-3-[[2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-phenylacetyl]amino]-3-methoxy-2-oxoazetidine-1-sulfonate |
|---|---|
| PubChem CID | 23692943 |
| Molecular Formula | C19H22KN5O9S |
| Molecular Weight | 535.58 g/mol |
| Exact Mass | 535.08 |
| IUPAC Name | potassium (3R)-3-[[2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-phenylacetyl]amino]-3-methoxy-2-oxoazetidine-1-sulfonate |
| SMILES | CCN1CCN(C(=O)NC(C(=O)N[C@@]2(OC)CN(S(=O)(=O)[O-])C2=O)c2ccccc2)C(=O)C1=O.[K+] |
| InChI | InChI=1S/C19H23N5O9S.K/c1-3-22-9-10-23(16(27)15(22)26)18(29)20-13(12-7-5-4-6-8-12)14(25)21-19(33-2)11-24(17(19)28)34(30,31)32;/h4-8,13H,3,9-11H2,1-2H3,(H,20,29)(H,21,25)(H,30,31,32);/q;+1/p-1/t13?,19-;/m1./s1 |
| InChIKey | RRZHDMJOIFDBES-GCARXRRQSA-M |
| XLogP | -5.11 |
| TPSA | 185.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.58 |
| LogP ≤ 5 | -5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|