C15H16ClN3O4 — CID 13212084
(2R)-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-phenylacetyl chloride (PubChem CID 13212084) has the molecular formula C15H16ClN3O4 and a molecular weight of 337.76 g/mol. Its IUPAC name is (2R)-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-phenylacetyl chloride.
| Compound Name | (2R)-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-phenylacetyl chloride |
|---|---|
| PubChem CID | 13212084 |
| Molecular Formula | C15H16ClN3O4 |
| Molecular Weight | 337.76 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | (2R)-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-phenylacetyl chloride |
| SMILES | CCN1CCN(C(=O)N[C@@H](C(=O)Cl)c2ccccc2)C(=O)C1=O |
| InChI | InChI=1S/C15H16ClN3O4/c1-2-18-8-9-19(14(22)13(18)21)15(23)17-11(12(16)20)10-6-4-3-5-7-10/h3-7,11H,2,8-9H2,1H3,(H,17,23)/t11-/m1/s1 |
| InChIKey | OXGIEQIKQQIROK-LLVKDONJSA-N |
| XLogP | 0.89 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.76 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|