C20H23N5O6S — CID 152768522
S-[(2R,3R)-3-[[(2R)-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-phenylacetyl]amino]-4-oxoazetidin-2-yl] ethanethioate (PubChem CID 152768522) has the molecular formula C20H23N5O6S and a molecular weight of 461.50 g/mol. Its IUPAC name is S-[(2R,3R)-3-[[(2R)-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-phenylacetyl]amino]-4-oxoazetidin-2-yl] ethanethioate.
| Compound Name | S-[(2R,3R)-3-[[(2R)-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-phenylacetyl]amino]-4-oxoazetidin-2-yl] ethanethioate |
|---|---|
| PubChem CID | 152768522 |
| Molecular Formula | C20H23N5O6S |
| Molecular Weight | 461.50 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | S-[(2R,3R)-3-[[(2R)-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-phenylacetyl]amino]-4-oxoazetidin-2-yl] ethanethioate |
| SMILES | CCN1CCN(C(=O)N[C@@H](C(=O)N[C@@H]2C(=O)N[C@@H]2SC(C)=O)c2ccccc2)C(=O)C1=O |
| InChI | InChI=1S/C20H23N5O6S/c1-3-24-9-10-25(19(30)18(24)29)20(31)22-13(12-7-5-4-6-8-12)15(27)21-14-16(28)23-17(14)32-11(2)26/h4-8,13-14,17H,3,9-10H2,1-2H3,(H,21,27)(H,22,31)(H,23,28)/t13-,14-,17-/m1/s1 |
| InChIKey | BMPDYAADFJEQAK-CKEIUWERSA-N |
| XLogP | -0.65 |
| TPSA | 144.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.50 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|