C25H24Cl3N5O8 — CID 154476794
2,2,2-trichloroethyl (5S)-6-[[2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-phenylacetyl]amino]-3-methyl-4,7-dioxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate (PubChem CID 154476794) has the molecular formula C25H24Cl3N5O8 and a molecular weight of 628.85 g/mol. Its IUPAC name is 2,2,2-trichloroethyl (5S)-6-[[2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-phenylacetyl]amino]-3-methyl-4,7-dioxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate.
| Compound Name | 2,2,2-trichloroethyl (5S)-6-[[2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-phenylacetyl]amino]-3-methyl-4,7-dioxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 154476794 |
| Molecular Formula | C25H24Cl3N5O8 |
| Molecular Weight | 628.85 g/mol |
| Exact Mass | 627.07 |
| IUPAC Name | 2,2,2-trichloroethyl (5S)-6-[[2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-phenylacetyl]amino]-3-methyl-4,7-dioxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
| SMILES | CCN1CCN(C(=O)NC(C(=O)NC2C(=O)N3C(C(=O)OCC(Cl)(Cl)Cl)=C(C)C(=O)[C@H]23)c2ccccc2)C(=O)C1=O |
| InChI | InChI=1S/C25H24Cl3N5O8/c1-3-31-9-10-32(22(38)21(31)37)24(40)30-14(13-7-5-4-6-8-13)19(35)29-15-17-18(34)12(2)16(33(17)20(15)36)23(39)41-11-25(26,27)28/h4-8,14-15,17H,3,9-11H2,1-2H3,(H,29,35)(H,30,40)/t14?,15?,17-/m0/s1 |
| InChIKey | MOJRLXWBFNBBPR-DQPZFDDXSA-N |
| XLogP | 0.59 |
| TPSA | 162.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.85 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|