C26H28N6O10S — CID 56621616
(6R,7S)-3-[acetyloxy-[[2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-phenylacetyl]amino]methyl]-7-formamido-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 56621616) has the molecular formula C26H28N6O10S and a molecular weight of 616.61 g/mol. Its IUPAC name is (6R,7S)-3-[acetyloxy-[[2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-phenylacetyl]amino]methyl]-7-formamido-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R,7S)-3-[acetyloxy-[[2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-phenylacetyl]amino]methyl]-7-formamido-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 56621616 |
| Molecular Formula | C26H28N6O10S |
| Molecular Weight | 616.61 g/mol |
| Exact Mass | 616.16 |
| IUPAC Name | (6R,7S)-3-[acetyloxy-[[2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-phenylacetyl]amino]methyl]-7-formamido-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CCN1CCN(C(=O)NC(C(=O)NC(OC(C)=O)C2=C(C(=O)O)N3C(=O)[C@H](NC=O)[C@H]3SC2)c2ccccc2)C(=O)C1=O |
| InChI | InChI=1S/C26H28N6O10S/c1-3-30-9-10-31(23(38)22(30)37)26(41)28-16(14-7-5-4-6-8-14)19(35)29-20(42-13(2)34)15-11-43-24-17(27-12-33)21(36)32(24)18(15)25(39)40/h4-8,12,16-17,20,24H,3,9-11H2,1-2H3,(H,27,33)(H,28,41)(H,29,35)(H,39,40)/t16?,17-,20?,24+/m0/s1 |
| InChIKey | BWZFOSJDBHQHGL-YSGCCLFSSA-N |
| XLogP | -1.50 |
| TPSA | 211.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.61 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|