C23H28N4O7S — CID 56609539
tert-butyl (6R,7S)-3-[acetyloxy-[(2-amino-2-phenylacetyl)amino]methyl]-7-formamido-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 56609539) has the molecular formula C23H28N4O7S and a molecular weight of 504.57 g/mol. Its IUPAC name is tert-butyl (6R,7S)-3-[acetyloxy-[(2-amino-2-phenylacetyl)amino]methyl]-7-formamido-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | tert-butyl (6R,7S)-3-[acetyloxy-[(2-amino-2-phenylacetyl)amino]methyl]-7-formamido-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 56609539 |
| Molecular Formula | C23H28N4O7S |
| Molecular Weight | 504.57 g/mol |
| Exact Mass | 504.17 |
| IUPAC Name | tert-butyl (6R,7S)-3-[acetyloxy-[(2-amino-2-phenylacetyl)amino]methyl]-7-formamido-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CC(=O)OC(NC(=O)C(N)c1ccccc1)C1=C(C(=O)OC(C)(C)C)N2C(=O)[C@H](NC=O)[C@H]2SC1 |
| InChI | InChI=1S/C23H28N4O7S/c1-12(29)33-19(26-18(30)15(24)13-8-6-5-7-9-13)14-10-35-21-16(25-11-28)20(31)27(21)17(14)22(32)34-23(2,3)4/h5-9,11,15-16,19,21H,10,24H2,1-4H3,(H,25,28)(H,26,30)/t15?,16-,19?,21+/m0/s1 |
| InChIKey | FOQBCCDOXLEWLQ-URKGWXMLSA-N |
| XLogP | 0.32 |
| TPSA | 157.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.57 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|