C12H16N2O4S — CID 54481333
tert-butyl (6S)-7-formamido-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 54481333) has the molecular formula C12H16N2O4S and a molecular weight of 284.34 g/mol. Its IUPAC name is tert-butyl (6S)-7-formamido-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | tert-butyl (6S)-7-formamido-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 54481333 |
| Molecular Formula | C12H16N2O4S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | tert-butyl (6S)-7-formamido-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1=CCS[C@H]2C(NC=O)C(=O)N12 |
| InChI | InChI=1S/C12H16N2O4S/c1-12(2,3)18-11(17)7-4-5-19-10-8(13-6-15)9(16)14(7)10/h4,6,8,10H,5H2,1-3H3,(H,13,15)/t8?,10-/m0/s1 |
| InChIKey | XPEQGEJHOWACTI-HTLJXXAVSA-N |
| XLogP | 0.24 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|